C21H21N3O3S — CID 16555630
5-[3-cyclopropyl-2-(4-ethoxyphenyl)imino-1,3-thiazol-4-yl]-2-hydroxybenzamide (PubChem CID 16555630) has the molecular formula C21H21N3O3S and a molecular weight of 395.48 g/mol. Its IUPAC name is 5-[3-cyclopropyl-2-(4-ethoxyphenyl)imino-1,3-thiazol-4-yl]-2-hydroxybenzamide.
| Compound Name | 5-[3-cyclopropyl-2-(4-ethoxyphenyl)imino-1,3-thiazol-4-yl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 16555630 |
| Molecular Formula | C21H21N3O3S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 5-[3-cyclopropyl-2-(4-ethoxyphenyl)imino-1,3-thiazol-4-yl]-2-hydroxybenzamide |
| SMILES | CCOc1ccc(/N=c2\scc(-c3ccc(O)c(C(N)=O)c3)n2C2CC2)cc1 |
| InChI | InChI=1S/C21H21N3O3S/c1-2-27-16-8-4-14(5-9-16)23-21-24(15-6-7-15)18(12-28-21)13-3-10-19(25)17(11-13)20(22)26/h3-5,8-12,15,25H,2,6-7H2,1H3,(H2,22,26)/b23-21- |
| InChIKey | UGGBLVKJATZPMZ-LNVKXUELSA-N |
| XLogP | 3.99 |
| TPSA | 89.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|