C23H23ClN2O2S — CID 4263701
N-(2-chlorophenyl)-3-cyclohexyl-4-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-imine (PubChem CID 4263701) has the molecular formula C23H23ClN2O2S and a molecular weight of 426.97 g/mol. Its IUPAC name is N-(2-chlorophenyl)-3-cyclohexyl-4-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-imine.
| Compound Name | N-(2-chlorophenyl)-3-cyclohexyl-4-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 4263701 |
| Molecular Formula | C23H23ClN2O2S |
| Molecular Weight | 426.97 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | N-(2-chlorophenyl)-3-cyclohexyl-4-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-imine |
| SMILES | Clc1ccccc1/N=c1\scc(-c2ccc3c(c2)OCCO3)n1C1CCCCC1 |
| InChI | InChI=1S/C23H23ClN2O2S/c24-18-8-4-5-9-19(18)25-23-26(17-6-2-1-3-7-17)20(15-29-23)16-10-11-21-22(14-16)28-13-12-27-21/h4-5,8-11,14-15,17H,1-3,6-7,12-13H2/b25-23- |
| InChIKey | QEDCWRPRPVFRFT-BZZOAKBMSA-N |
| XLogP | 6.38 |
| TPSA | 35.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.97 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|