C22H22FN3O2S — CID 23736664
3-cycloheptyl-N-(2-fluorophenyl)-4-(3-nitrophenyl)-1,3-thiazol-2-imine (PubChem CID 23736664) has the molecular formula C22H22FN3O2S and a molecular weight of 411.50 g/mol. Its IUPAC name is 3-cycloheptyl-N-(2-fluorophenyl)-4-(3-nitrophenyl)-1,3-thiazol-2-imine.
| Compound Name | 3-cycloheptyl-N-(2-fluorophenyl)-4-(3-nitrophenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23736664 |
| Molecular Formula | C22H22FN3O2S |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | 3-cycloheptyl-N-(2-fluorophenyl)-4-(3-nitrophenyl)-1,3-thiazol-2-imine |
| SMILES | O=[N+]([O-])c1cccc(-c2cs/c(=N\c3ccccc3F)n2C2CCCCCC2)c1 |
| InChI | InChI=1S/C22H22FN3O2S/c23-19-12-5-6-13-20(19)24-22-25(17-9-3-1-2-4-10-17)21(15-29-22)16-8-7-11-18(14-16)26(27)28/h5-8,11-15,17H,1-4,9-10H2/b24-22- |
| InChIKey | XMWWJWIUFBGIKI-GYHWCHFESA-N |
| XLogP | 6.39 |
| TPSA | 60.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|