C26H31N3O2S — CID 23821694
4-(4-cyclohexylphenyl)-N-(2-nitrophenyl)-3-pentan-2-yl-1,3-thiazol-2-imine (PubChem CID 23821694) has the molecular formula C26H31N3O2S and a molecular weight of 449.62 g/mol. Its IUPAC name is 4-(4-cyclohexylphenyl)-N-(2-nitrophenyl)-3-pentan-2-yl-1,3-thiazol-2-imine.
| Compound Name | 4-(4-cyclohexylphenyl)-N-(2-nitrophenyl)-3-pentan-2-yl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23821694 |
| Molecular Formula | C26H31N3O2S |
| Molecular Weight | 449.62 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | 4-(4-cyclohexylphenyl)-N-(2-nitrophenyl)-3-pentan-2-yl-1,3-thiazol-2-imine |
| SMILES | CCCC(C)n1c(-c2ccc(C3CCCCC3)cc2)cs/c1=N\c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H31N3O2S/c1-3-9-19(2)28-25(22-16-14-21(15-17-22)20-10-5-4-6-11-20)18-32-26(28)27-23-12-7-8-13-24(23)29(30)31/h7-8,12-20H,3-6,9-11H2,1-2H3/b27-26- |
| InChIKey | PWULAEXJQLJNNB-RQZHXJHFSA-N |
| XLogP | 7.77 |
| TPSA | 60.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.62 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|