C25H31N3O2S — CID 23967551
N-(2,6-dimethylphenyl)-3-(6-methylheptan-2-yl)-4-(4-nitrophenyl)-1,3-thiazol-2-imine (PubChem CID 23967551) has the molecular formula C25H31N3O2S and a molecular weight of 437.61 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-3-(6-methylheptan-2-yl)-4-(4-nitrophenyl)-1,3-thiazol-2-imine.
| Compound Name | N-(2,6-dimethylphenyl)-3-(6-methylheptan-2-yl)-4-(4-nitrophenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23967551 |
| Molecular Formula | C25H31N3O2S |
| Molecular Weight | 437.61 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | N-(2,6-dimethylphenyl)-3-(6-methylheptan-2-yl)-4-(4-nitrophenyl)-1,3-thiazol-2-imine |
| SMILES | Cc1cccc(C)c1/N=c1\scc(-c2ccc([N+](=O)[O-])cc2)n1C(C)CCCC(C)C |
| InChI | InChI=1S/C25H31N3O2S/c1-17(2)8-6-11-20(5)27-23(21-12-14-22(15-13-21)28(29)30)16-31-25(27)26-24-18(3)9-7-10-19(24)4/h7,9-10,12-17,20H,6,8,11H2,1-5H3/b26-25- |
| InChIKey | NFUFVZNJSBACMI-QPLCGJKRSA-N |
| XLogP | 7.36 |
| TPSA | 60.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.61 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|