C27H23FN4O2S — CID 23962862
3-[(5,7-dimethyl-3,4-dihydro-2H-naphthalen-1-ylidene)amino]-N-(4-fluorophenyl)-4-(4-nitrophenyl)-1,3-thiazol-2-imine (PubChem CID 23962862) has the molecular formula C27H23FN4O2S and a molecular weight of 486.57 g/mol. Its IUPAC name is 3-[(5,7-dimethyl-3,4-dihydro-2H-naphthalen-1-ylidene)amino]-N-(4-fluorophenyl)-4-(4-nitrophenyl)-1,3-thiazol-2-imine.
| Compound Name | 3-[(5,7-dimethyl-3,4-dihydro-2H-naphthalen-1-ylidene)amino]-N-(4-fluorophenyl)-4-(4-nitrophenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23962862 |
| Molecular Formula | C27H23FN4O2S |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | 3-[(5,7-dimethyl-3,4-dihydro-2H-naphthalen-1-ylidene)amino]-N-(4-fluorophenyl)-4-(4-nitrophenyl)-1,3-thiazol-2-imine |
| SMILES | Cc1cc(C)c2c(c1)C(=Nn1c(-c3ccc([N+](=O)[O-])cc3)cs/c1=N\c1ccc(F)cc1)CCC2 |
| InChI | InChI=1S/C27H23FN4O2S/c1-17-14-18(2)23-4-3-5-25(24(23)15-17)30-31-26(19-6-12-22(13-7-19)32(33)34)16-35-27(31)29-21-10-8-20(28)9-11-21/h6-16H,3-5H2,1-2H3/b29-27-,30-25? |
| InChIKey | RVOABFUPSIUPNT-UXKCAUHDSA-N |
| XLogP | 6.70 |
| TPSA | 72.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|