C20H13Cl2N5O2S — CID 135847481
N-(3,4-dichlorophenyl)-4-(4-nitrophenyl)-3-(1H-pyrrol-2-ylmethylideneamino)-1,3-thiazol-2-imine (PubChem CID 135847481) has the molecular formula C20H13Cl2N5O2S and a molecular weight of 458.33 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-4-(4-nitrophenyl)-3-(1H-pyrrol-2-ylmethylideneamino)-1,3-thiazol-2-imine.
| Compound Name | N-(3,4-dichlorophenyl)-4-(4-nitrophenyl)-3-(1H-pyrrol-2-ylmethylideneamino)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 135847481 |
| Molecular Formula | C20H13Cl2N5O2S |
| Molecular Weight | 458.33 g/mol |
| Exact Mass | 457.02 |
| IUPAC Name | N-(3,4-dichlorophenyl)-4-(4-nitrophenyl)-3-(1H-pyrrol-2-ylmethylideneamino)-1,3-thiazol-2-imine |
| SMILES | O=[N+]([O-])c1ccc(-c2cs/c(=N\c3ccc(Cl)c(Cl)c3)n2N=Cc2ccc[nH]2)cc1 |
| InChI | InChI=1S/C20H13Cl2N5O2S/c21-17-8-5-14(10-18(17)22)25-20-26(24-11-15-2-1-9-23-15)19(12-30-20)13-3-6-16(7-4-13)27(28)29/h1-12,23H/b24-11?,25-20- |
| InChIKey | IBLMFSXAVOJIAK-OGNRGYFLSA-N |
| XLogP | 5.87 |
| TPSA | 88.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.33 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|