C24H23N5O2S — CID 23799110
3-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methylideneamino]-4-(4-nitrophenyl)-N-pyridin-3-yl-1,3-thiazol-2-imine (PubChem CID 23799110) has the molecular formula C24H23N5O2S and a molecular weight of 445.55 g/mol. Its IUPAC name is 3-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methylideneamino]-4-(4-nitrophenyl)-N-pyridin-3-yl-1,3-thiazol-2-imine.
| Compound Name | 3-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methylideneamino]-4-(4-nitrophenyl)-N-pyridin-3-yl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23799110 |
| Molecular Formula | C24H23N5O2S |
| Molecular Weight | 445.55 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | 3-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methylideneamino]-4-(4-nitrophenyl)-N-pyridin-3-yl-1,3-thiazol-2-imine |
| SMILES | CC1(C)C2CC=C(C=Nn3c(-c4ccc([N+](=O)[O-])cc4)cs/c3=N\c3cccnc3)C1C2 |
| InChI | InChI=1S/C24H23N5O2S/c1-24(2)18-8-5-17(21(24)12-18)13-26-28-22(16-6-9-20(10-7-16)29(30)31)15-32-23(28)27-19-4-3-11-25-14-19/h3-7,9-11,13-15,18,21H,8,12H2,1-2H3/b26-13?,27-23- |
| InChIKey | NUWLUZCVRUMTFH-VPBBEKCQSA-N |
| XLogP | 5.58 |
| TPSA | 85.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.55 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|