C25H23N5O4S — CID 23912543
3-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methylideneamino]-N-(2-nitrophenyl)-4-(4-nitrophenyl)-1,3-thiazol-2-imine (PubChem CID 23912543) has the molecular formula C25H23N5O4S and a molecular weight of 489.56 g/mol. Its IUPAC name is 3-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methylideneamino]-N-(2-nitrophenyl)-4-(4-nitrophenyl)-1,3-thiazol-2-imine.
| Compound Name | 3-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methylideneamino]-N-(2-nitrophenyl)-4-(4-nitrophenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23912543 |
| Molecular Formula | C25H23N5O4S |
| Molecular Weight | 489.56 g/mol |
| Exact Mass | 489.15 |
| IUPAC Name | 3-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methylideneamino]-N-(2-nitrophenyl)-4-(4-nitrophenyl)-1,3-thiazol-2-imine |
| SMILES | CC1(C)C2CC=C(C=Nn3c(-c4ccc([N+](=O)[O-])cc4)cs/c3=N\c3ccccc3[N+](=O)[O-])C1C2 |
| InChI | InChI=1S/C25H23N5O4S/c1-25(2)18-10-7-17(20(25)13-18)14-26-28-23(16-8-11-19(12-9-16)29(31)32)15-35-24(28)27-21-5-3-4-6-22(21)30(33)34/h3-9,11-12,14-15,18,20H,10,13H2,1-2H3/b26-14?,27-24- |
| InChIKey | DSRJTIKGVIQCMC-UBBZGUQLSA-N |
| XLogP | 6.09 |
| TPSA | 115.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.56 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|