C24H21N5O5S — CID 23963369
N-(2-nitrophenyl)-3-(pyridin-2-ylmethylideneamino)-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-imine (PubChem CID 23963369) has the molecular formula C24H21N5O5S and a molecular weight of 491.53 g/mol. Its IUPAC name is N-(2-nitrophenyl)-3-(pyridin-2-ylmethylideneamino)-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-imine.
| Compound Name | N-(2-nitrophenyl)-3-(pyridin-2-ylmethylideneamino)-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23963369 |
| Molecular Formula | C24H21N5O5S |
| Molecular Weight | 491.53 g/mol |
| Exact Mass | 491.13 |
| IUPAC Name | N-(2-nitrophenyl)-3-(pyridin-2-ylmethylideneamino)-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-imine |
| SMILES | COc1cc(-c2cs/c(=N\c3ccccc3[N+](=O)[O-])n2N=Cc2ccccn2)cc(OC)c1OC |
| InChI | InChI=1S/C24H21N5O5S/c1-32-21-12-16(13-22(33-2)23(21)34-3)20-15-35-24(27-18-9-4-5-10-19(18)29(30)31)28(20)26-14-17-8-6-7-11-25-17/h4-15H,1-3H3/b26-14?,27-24- |
| InChIKey | NIHSQWANQOYIIQ-UBBZGUQLSA-N |
| XLogP | 4.66 |
| TPSA | 113.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.53 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|