C14H11N5O3S — CID 23736449
4-methyl-3-[(5-nitrofuran-2-yl)methylideneamino]-N-pyridin-3-yl-1,3-thiazol-2-imine (PubChem CID 23736449) has the molecular formula C14H11N5O3S and a molecular weight of 329.34 g/mol. Its IUPAC name is 4-methyl-3-[(5-nitrofuran-2-yl)methylideneamino]-N-pyridin-3-yl-1,3-thiazol-2-imine.
| Compound Name | 4-methyl-3-[(5-nitrofuran-2-yl)methylideneamino]-N-pyridin-3-yl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23736449 |
| Molecular Formula | C14H11N5O3S |
| Molecular Weight | 329.34 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | 4-methyl-3-[(5-nitrofuran-2-yl)methylideneamino]-N-pyridin-3-yl-1,3-thiazol-2-imine |
| SMILES | Cc1cs/c(=N\c2cccnc2)n1N=Cc1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C14H11N5O3S/c1-10-9-23-14(17-11-3-2-6-15-7-11)18(10)16-8-12-4-5-13(22-12)19(20)21/h2-9H,1H3/b16-8?,17-14- |
| InChIKey | GGDYSOOFSSFQNR-PLWDZDGTSA-N |
| XLogP | 2.87 |
| TPSA | 98.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.34 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|