C20H12Cl2F2N4S — CID 135798931
4-(2,4-dichlorophenyl)-N-(2,4-difluorophenyl)-3-(1H-pyrrol-2-ylmethylideneamino)-1,3-thiazol-2-imine (PubChem CID 135798931) has the molecular formula C20H12Cl2F2N4S and a molecular weight of 449.31 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-N-(2,4-difluorophenyl)-3-(1H-pyrrol-2-ylmethylideneamino)-1,3-thiazol-2-imine.
| Compound Name | 4-(2,4-dichlorophenyl)-N-(2,4-difluorophenyl)-3-(1H-pyrrol-2-ylmethylideneamino)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 135798931 |
| Molecular Formula | C20H12Cl2F2N4S |
| Molecular Weight | 449.31 g/mol |
| Exact Mass | 448.01 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-N-(2,4-difluorophenyl)-3-(1H-pyrrol-2-ylmethylideneamino)-1,3-thiazol-2-imine |
| SMILES | Fc1ccc(/N=c2\scc(-c3ccc(Cl)cc3Cl)n2N=Cc2ccc[nH]2)c(F)c1 |
| InChI | InChI=1S/C20H12Cl2F2N4S/c21-12-3-5-15(16(22)8-12)19-11-29-20(27-18-6-4-13(23)9-17(18)24)28(19)26-10-14-2-1-7-25-14/h1-11,25H/b26-10?,27-20- |
| InChIKey | MWJSTSCOQLEEEC-GMPRNEFLSA-N |
| XLogP | 6.24 |
| TPSA | 45.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.31 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|