C24H15F2N3O2S — CID 135554074
2-[[4-(1-benzofuran-2-yl)-2-(2,4-difluorophenyl)imino-1,3-thiazol-3-yl]iminomethyl]phenol (PubChem CID 135554074) has the molecular formula C24H15F2N3O2S and a molecular weight of 447.47 g/mol. Its IUPAC name is 2-[[4-(1-benzofuran-2-yl)-2-(2,4-difluorophenyl)imino-1,3-thiazol-3-yl]iminomethyl]phenol.
| Compound Name | 2-[[4-(1-benzofuran-2-yl)-2-(2,4-difluorophenyl)imino-1,3-thiazol-3-yl]iminomethyl]phenol |
|---|---|
| PubChem CID | 135554074 |
| Molecular Formula | C24H15F2N3O2S |
| Molecular Weight | 447.47 g/mol |
| Exact Mass | 447.09 |
| IUPAC Name | 2-[[4-(1-benzofuran-2-yl)-2-(2,4-difluorophenyl)imino-1,3-thiazol-3-yl]iminomethyl]phenol |
| SMILES | Oc1ccccc1C=Nn1c(-c2cc3ccccc3o2)cs/c1=N\c1ccc(F)cc1F |
| InChI | InChI=1S/C24H15F2N3O2S/c25-17-9-10-19(18(26)12-17)28-24-29(27-13-16-6-1-3-7-21(16)30)20(14-32-24)23-11-15-5-2-4-8-22(15)31-23/h1-14,30H/b27-13?,28-24- |
| InChIKey | QDZGKGRETBNBIK-CIOVLDNHSA-N |
| XLogP | 6.06 |
| TPSA | 63.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.47 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|