C26H21N3O3S — CID 135618853
3-[[4-(1-benzofuran-2-yl)-2-(2,5-dimethylphenyl)imino-1,3-thiazol-3-yl]iminomethyl]benzene-1,2-diol (PubChem CID 135618853) has the molecular formula C26H21N3O3S and a molecular weight of 455.54 g/mol. Its IUPAC name is 3-[[4-(1-benzofuran-2-yl)-2-(2,5-dimethylphenyl)imino-1,3-thiazol-3-yl]iminomethyl]benzene-1,2-diol.
| Compound Name | 3-[[4-(1-benzofuran-2-yl)-2-(2,5-dimethylphenyl)imino-1,3-thiazol-3-yl]iminomethyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 135618853 |
| Molecular Formula | C26H21N3O3S |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | 3-[[4-(1-benzofuran-2-yl)-2-(2,5-dimethylphenyl)imino-1,3-thiazol-3-yl]iminomethyl]benzene-1,2-diol |
| SMILES | Cc1ccc(C)c(/N=c2\scc(-c3cc4ccccc4o3)n2N=Cc2cccc(O)c2O)c1 |
| InChI | InChI=1S/C26H21N3O3S/c1-16-10-11-17(2)20(12-16)28-26-29(27-14-19-7-5-8-22(30)25(19)31)21(15-33-26)24-13-18-6-3-4-9-23(18)32-24/h3-15,30-31H,1-2H3/b27-14?,28-26- |
| InChIKey | HFZHFEMVPVXBLE-UKFFKAJFSA-N |
| XLogP | 6.11 |
| TPSA | 83.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|