C19H19N3O2S — CID 135847498
4-[[2-(2,5-dimethylphenyl)imino-4-methyl-1,3-thiazol-3-yl]iminomethyl]benzene-1,3-diol (PubChem CID 135847498) has the molecular formula C19H19N3O2S and a molecular weight of 353.45 g/mol. Its IUPAC name is 4-[[2-(2,5-dimethylphenyl)imino-4-methyl-1,3-thiazol-3-yl]iminomethyl]benzene-1,3-diol.
| Compound Name | 4-[[2-(2,5-dimethylphenyl)imino-4-methyl-1,3-thiazol-3-yl]iminomethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 135847498 |
| Molecular Formula | C19H19N3O2S |
| Molecular Weight | 353.45 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | 4-[[2-(2,5-dimethylphenyl)imino-4-methyl-1,3-thiazol-3-yl]iminomethyl]benzene-1,3-diol |
| SMILES | Cc1ccc(C)c(/N=c2\scc(C)n2N=Cc2ccc(O)cc2O)c1 |
| InChI | InChI=1S/C19H19N3O2S/c1-12-4-5-13(2)17(8-12)21-19-22(14(3)11-25-19)20-10-15-6-7-16(23)9-18(15)24/h4-11,23-24H,1-3H3/b20-10?,21-19- |
| InChIKey | RCEPXDAKECBUEK-WXTJIABQSA-N |
| XLogP | 4.00 |
| TPSA | 70.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.45 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|