C23H24N4O2S — CID 135709567
2-[[4-(1-benzofuran-2-yl)-2-methylimino-1,3-thiazol-3-yl]iminomethyl]-5-(diethylamino)phenol (PubChem CID 135709567) has the molecular formula C23H24N4O2S and a molecular weight of 420.54 g/mol. Its IUPAC name is 2-[[4-(1-benzofuran-2-yl)-2-methylimino-1,3-thiazol-3-yl]iminomethyl]-5-(diethylamino)phenol.
| Compound Name | 2-[[4-(1-benzofuran-2-yl)-2-methylimino-1,3-thiazol-3-yl]iminomethyl]-5-(diethylamino)phenol |
|---|---|
| PubChem CID | 135709567 |
| Molecular Formula | C23H24N4O2S |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | 2-[[4-(1-benzofuran-2-yl)-2-methylimino-1,3-thiazol-3-yl]iminomethyl]-5-(diethylamino)phenol |
| SMILES | CCN(CC)c1ccc(C=Nn2c(-c3cc4ccccc4o3)cs/c2=N\C)c(O)c1 |
| InChI | InChI=1S/C23H24N4O2S/c1-4-26(5-2)18-11-10-17(20(28)13-18)14-25-27-19(15-30-23(27)24-3)22-12-16-8-6-7-9-21(16)29-22/h6-15,28H,4-5H2,1-3H3/b24-23-,25-14? |
| InChIKey | CFYSLVLUCITRGN-PIBHVZDMSA-N |
| XLogP | 4.93 |
| TPSA | 66.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|