C23H22ClN3O2S — CID 23850910
4-(3-chlorophenyl)-3-[2-(cyclohexen-1-yl)ethyl]-N-(2-nitrophenyl)-1,3-thiazol-2-imine (PubChem CID 23850910) has the molecular formula C23H22ClN3O2S and a molecular weight of 439.97 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-3-[2-(cyclohexen-1-yl)ethyl]-N-(2-nitrophenyl)-1,3-thiazol-2-imine.
| Compound Name | 4-(3-chlorophenyl)-3-[2-(cyclohexen-1-yl)ethyl]-N-(2-nitrophenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23850910 |
| Molecular Formula | C23H22ClN3O2S |
| Molecular Weight | 439.97 g/mol |
| Exact Mass | 439.11 |
| IUPAC Name | 4-(3-chlorophenyl)-3-[2-(cyclohexen-1-yl)ethyl]-N-(2-nitrophenyl)-1,3-thiazol-2-imine |
| SMILES | O=[N+]([O-])c1ccccc1/N=c1\scc(-c2cccc(Cl)c2)n1CCC1=CCCCC1 |
| InChI | InChI=1S/C23H22ClN3O2S/c24-19-10-6-9-18(15-19)22-16-30-23(25-20-11-4-5-12-21(20)27(28)29)26(22)14-13-17-7-2-1-3-8-17/h4-7,9-12,15-16H,1-3,8,13-14H2/b25-23- |
| InChIKey | GQRQACMGDNJLSV-BZZOAKBMSA-N |
| XLogP | 6.90 |
| TPSA | 60.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.97 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|