C16H14ClN3S2 — CID 23910396
3-[1-(2-chlorophenyl)ethylideneamino]-N-methyl-4-thiophen-2-yl-1,3-thiazol-2-imine (PubChem CID 23910396) has the molecular formula C16H14ClN3S2 and a molecular weight of 347.90 g/mol. Its IUPAC name is 3-[1-(2-chlorophenyl)ethylideneamino]-N-methyl-4-thiophen-2-yl-1,3-thiazol-2-imine.
| Compound Name | 3-[1-(2-chlorophenyl)ethylideneamino]-N-methyl-4-thiophen-2-yl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23910396 |
| Molecular Formula | C16H14ClN3S2 |
| Molecular Weight | 347.90 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | 3-[1-(2-chlorophenyl)ethylideneamino]-N-methyl-4-thiophen-2-yl-1,3-thiazol-2-imine |
| SMILES | C/N=c1\scc(-c2cccs2)n1N=C(C)c1ccccc1Cl |
| InChI | InChI=1S/C16H14ClN3S2/c1-11(12-6-3-4-7-13(12)17)19-20-14(10-22-16(20)18-2)15-8-5-9-21-15/h3-10H,1-2H3/b18-16-,19-11? |
| InChIKey | KSQBOMYFIKTBGZ-GWLJXRGASA-N |
| XLogP | 4.73 |
| TPSA | 29.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.90 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|