C18H15FIN3S — CID 6901226
(E)-N-ethyl-4-(4-fluorophenyl)-3-[(E)-(2-iodophenyl)methylideneamino]-1,3-thiazol-2-imine (PubChem CID 6901226) has the molecular formula C18H15FIN3S and a molecular weight of 451.31 g/mol. Its IUPAC name is (E)-N-ethyl-4-(4-fluorophenyl)-3-[(E)-(2-iodophenyl)methylideneamino]-1,3-thiazol-2-imine.
| Compound Name | (E)-N-ethyl-4-(4-fluorophenyl)-3-[(E)-(2-iodophenyl)methylideneamino]-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 6901226 |
| Molecular Formula | C18H15FIN3S |
| Molecular Weight | 451.31 g/mol |
| Exact Mass | 451.00 |
| IUPAC Name | (E)-N-ethyl-4-(4-fluorophenyl)-3-[(E)-(2-iodophenyl)methylideneamino]-1,3-thiazol-2-imine |
| SMILES | CC/N=c1\scc(-c2ccc(F)cc2)n1/N=C/c1ccccc1I |
| InChI | InChI=1S/C18H15FIN3S/c1-2-21-18-23(22-11-14-5-3-4-6-16(14)20)17(12-24-18)13-7-9-15(19)10-8-13/h3-12H,2H2,1H3/b21-18-,22-11+ |
| InChIKey | PBRRTSMPEJMTJD-ZBJYABMISA-N |
| XLogP | 4.76 |
| TPSA | 29.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.31 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|