C31H27N3S — CID 2472240
3-[(2,5-dimethylphenyl)methylideneamino]-N-(3-methylphenyl)-4-(4-phenylphenyl)-1,3-thiazol-2-imine (PubChem CID 2472240) has the molecular formula C31H27N3S and a molecular weight of 473.65 g/mol. Its IUPAC name is 3-[(2,5-dimethylphenyl)methylideneamino]-N-(3-methylphenyl)-4-(4-phenylphenyl)-1,3-thiazol-2-imine.
| Compound Name | 3-[(2,5-dimethylphenyl)methylideneamino]-N-(3-methylphenyl)-4-(4-phenylphenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 2472240 |
| Molecular Formula | C31H27N3S |
| Molecular Weight | 473.65 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | 3-[(2,5-dimethylphenyl)methylideneamino]-N-(3-methylphenyl)-4-(4-phenylphenyl)-1,3-thiazol-2-imine |
| SMILES | Cc1cccc(/N=c2\scc(-c3ccc(-c4ccccc4)cc3)n2N=Cc2cc(C)ccc2C)c1 |
| InChI | InChI=1S/C31H27N3S/c1-22-8-7-11-29(19-22)33-31-34(32-20-28-18-23(2)12-13-24(28)3)30(21-35-31)27-16-14-26(15-17-27)25-9-5-4-6-10-25/h4-21H,1-3H3/b32-20?,33-31- |
| InChIKey | RHHVSXJCPGDMDH-YZKBAMODSA-N |
| XLogP | 7.92 |
| TPSA | 29.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.65 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|