C24H25N3O5S — CID 2392094
ethyl 4-[[3-[(2R)-1-methoxypropan-2-yl]-4-(3-oxo-4H-1,4-benzoxazin-6-yl)-1,3-thiazol-2-ylidene]amino]benzoate (PubChem CID 2392094) has the molecular formula C24H25N3O5S and a molecular weight of 467.55 g/mol. Its IUPAC name is ethyl 4-[[3-[(2R)-1-methoxypropan-2-yl]-4-(3-oxo-4H-1,4-benzoxazin-6-yl)-1,3-thiazol-2-ylidene]amino]benzoate.
| Compound Name | ethyl 4-[[3-[(2R)-1-methoxypropan-2-yl]-4-(3-oxo-4H-1,4-benzoxazin-6-yl)-1,3-thiazol-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 2392094 |
| Molecular Formula | C24H25N3O5S |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | ethyl 4-[[3-[(2R)-1-methoxypropan-2-yl]-4-(3-oxo-4H-1,4-benzoxazin-6-yl)-1,3-thiazol-2-ylidene]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(/N=c2\scc(-c3ccc4c(c3)NC(=O)CO4)n2[C@H](C)COC)cc1 |
| InChI | InChI=1S/C24H25N3O5S/c1-4-31-23(29)16-5-8-18(9-6-16)25-24-27(15(2)12-30-3)20(14-33-24)17-7-10-21-19(11-17)26-22(28)13-32-21/h5-11,14-15H,4,12-13H2,1-3H3,(H,26,28)/b25-24-/t15-/m1/s1 |
| InChIKey | FSVXKRLVRFLVRI-CVPAYYDFSA-N |
| XLogP | 4.16 |
| TPSA | 91.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|