C25H21N3O5S — CID 23931775
ethyl 4-[[3-(furan-2-ylmethyl)-4-(3-oxo-4H-1,4-benzoxazin-6-yl)-1,3-thiazol-2-ylidene]amino]benzoate (PubChem CID 23931775) has the molecular formula C25H21N3O5S and a molecular weight of 475.53 g/mol. Its IUPAC name is ethyl 4-[[3-(furan-2-ylmethyl)-4-(3-oxo-4H-1,4-benzoxazin-6-yl)-1,3-thiazol-2-ylidene]amino]benzoate.
| Compound Name | ethyl 4-[[3-(furan-2-ylmethyl)-4-(3-oxo-4H-1,4-benzoxazin-6-yl)-1,3-thiazol-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 23931775 |
| Molecular Formula | C25H21N3O5S |
| Molecular Weight | 475.53 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | ethyl 4-[[3-(furan-2-ylmethyl)-4-(3-oxo-4H-1,4-benzoxazin-6-yl)-1,3-thiazol-2-ylidene]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(/N=c2\scc(-c3ccc4c(c3)NC(=O)CO4)n2Cc2ccco2)cc1 |
| InChI | InChI=1S/C25H21N3O5S/c1-2-31-24(30)16-5-8-18(9-6-16)26-25-28(13-19-4-3-11-32-19)21(15-34-25)17-7-10-22-20(12-17)27-23(29)14-33-22/h3-12,15H,2,13-14H2,1H3,(H,27,29)/b26-25- |
| InChIKey | UNNDBWQDIPJKJD-QPLCGJKRSA-N |
| XLogP | 4.60 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.53 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|