C28H27N3O3S — CID 2436633
6-[2-(4-methoxyphenyl)imino-3-[(2S)-4-phenylbutan-2-yl]-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one (PubChem CID 2436633) has the molecular formula C28H27N3O3S and a molecular weight of 485.61 g/mol. Its IUPAC name is 6-[2-(4-methoxyphenyl)imino-3-[(2S)-4-phenylbutan-2-yl]-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[2-(4-methoxyphenyl)imino-3-[(2S)-4-phenylbutan-2-yl]-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 2436633 |
| Molecular Formula | C28H27N3O3S |
| Molecular Weight | 485.61 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | 6-[2-(4-methoxyphenyl)imino-3-[(2S)-4-phenylbutan-2-yl]-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
| SMILES | COc1ccc(/N=c2\scc(-c3ccc4c(c3)NC(=O)CO4)n2[C@@H](C)CCc2ccccc2)cc1 |
| InChI | InChI=1S/C28H27N3O3S/c1-19(8-9-20-6-4-3-5-7-20)31-25(21-10-15-26-24(16-21)30-27(32)17-34-26)18-35-28(31)29-22-11-13-23(33-2)14-12-22/h3-7,10-16,18-19H,8-9,17H2,1-2H3,(H,30,32)/b29-28-/t19-/m0/s1 |
| InChIKey | XEFNRHLMYBKBMA-LTYGUSDISA-N |
| XLogP | 5.98 |
| TPSA | 64.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.61 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|