C28H25N3O3S — CID 23766531
6-[2-(4-methoxyphenyl)imino-3-(1,2,3,4-tetrahydronaphthalen-1-yl)-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one (PubChem CID 23766531) has the molecular formula C28H25N3O3S and a molecular weight of 483.59 g/mol. Its IUPAC name is 6-[2-(4-methoxyphenyl)imino-3-(1,2,3,4-tetrahydronaphthalen-1-yl)-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[2-(4-methoxyphenyl)imino-3-(1,2,3,4-tetrahydronaphthalen-1-yl)-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 23766531 |
| Molecular Formula | C28H25N3O3S |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | 6-[2-(4-methoxyphenyl)imino-3-(1,2,3,4-tetrahydronaphthalen-1-yl)-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
| SMILES | COc1ccc(/N=c2\scc(-c3ccc4c(c3)NC(=O)CO4)n2C2CCCc3ccccc32)cc1 |
| InChI | InChI=1S/C28H25N3O3S/c1-33-21-12-10-20(11-13-21)29-28-31(24-8-4-6-18-5-2-3-7-22(18)24)25(17-35-28)19-9-14-26-23(15-19)30-27(32)16-34-26/h2-3,5,7,9-15,17,24H,4,6,8,16H2,1H3,(H,30,32)/b29-28- |
| InChIKey | UHWIVPSSFZLRKJ-ZIADKAODSA-N |
| XLogP | 5.71 |
| TPSA | 64.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|