C16H14N3O5S- — CID 6988865
2-[(5R)-3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2,4-dioxo-1,3-thiazolidin-5-yl]acetate (PubChem CID 6988865) has the molecular formula C16H14N3O5S- and a molecular weight of 360.37 g/mol. Its IUPAC name is 2-[(5R)-3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2,4-dioxo-1,3-thiazolidin-5-yl]acetate.
| Compound Name | 2-[(5R)-3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2,4-dioxo-1,3-thiazolidin-5-yl]acetate |
|---|---|
| PubChem CID | 6988865 |
| Molecular Formula | C16H14N3O5S- |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | 2-[(5R)-3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2,4-dioxo-1,3-thiazolidin-5-yl]acetate |
| SMILES | Cc1c(N2C(=O)S[C@H](CC(=O)[O-])C2=O)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C16H15N3O5S/c1-9-13(18-14(22)11(8-12(20)21)25-16(18)24)15(23)19(17(9)2)10-6-4-3-5-7-10/h3-7,11H,8H2,1-2H3,(H,20,21)/p-1/t11-/m1/s1 |
| InChIKey | YRCKDKJENWKOHS-LLVKDONJSA-M |
| XLogP | 0.19 |
| TPSA | 104.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|