C19H18N3O5S- — CID 6960528
2-[benzenesulfonyl-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]acetate (PubChem CID 6960528) has the molecular formula C19H18N3O5S- and a molecular weight of 400.44 g/mol. Its IUPAC name is 2-[benzenesulfonyl-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]acetate.
| Compound Name | 2-[benzenesulfonyl-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]acetate |
|---|---|
| PubChem CID | 6960528 |
| Molecular Formula | C19H18N3O5S- |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | 2-[benzenesulfonyl-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]acetate |
| SMILES | Cc1c(N(CC(=O)[O-])S(=O)(=O)c2ccccc2)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C19H19N3O5S/c1-14-18(19(25)22(20(14)2)15-9-5-3-6-10-15)21(13-17(23)24)28(26,27)16-11-7-4-8-12-16/h3-12H,13H2,1-2H3,(H,23,24)/p-1 |
| InChIKey | OPKBTAKPMSRHLF-UHFFFAOYSA-M |
| XLogP | 0.43 |
| TPSA | 104.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |