C17H18ClN5O — CID 90795843
4-(2,4-diamino-5-chloroanilino)-1,5-dimethyl-2-phenylpyrazol-3-one (PubChem CID 90795843) has the molecular formula C17H18ClN5O and a molecular weight of 343.82 g/mol. Its IUPAC name is 4-(2,4-diamino-5-chloroanilino)-1,5-dimethyl-2-phenylpyrazol-3-one.
| Compound Name | 4-(2,4-diamino-5-chloroanilino)-1,5-dimethyl-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 90795843 |
| Molecular Formula | C17H18ClN5O |
| Molecular Weight | 343.82 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 4-(2,4-diamino-5-chloroanilino)-1,5-dimethyl-2-phenylpyrazol-3-one |
| SMILES | Cc1c(Nc2cc(Cl)c(N)cc2N)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C17H18ClN5O/c1-10-16(21-15-8-12(18)13(19)9-14(15)20)17(24)23(22(10)2)11-6-4-3-5-7-11/h3-9,21H,19-20H2,1-2H3 |
| InChIKey | RDDWCLFMHJKBEC-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 91.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.82 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|