C19H20ClN3O2 — CID 3493662
4-[1-(5-chloro-2-hydroxyphenyl)ethylamino]-1,5-dimethyl-2-phenylpyrazol-3-one (PubChem CID 3493662) has the molecular formula C19H20ClN3O2 and a molecular weight of 357.84 g/mol. Its IUPAC name is 4-[1-(5-chloro-2-hydroxyphenyl)ethylamino]-1,5-dimethyl-2-phenylpyrazol-3-one.
| Compound Name | 4-[1-(5-chloro-2-hydroxyphenyl)ethylamino]-1,5-dimethyl-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 3493662 |
| Molecular Formula | C19H20ClN3O2 |
| Molecular Weight | 357.84 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 4-[1-(5-chloro-2-hydroxyphenyl)ethylamino]-1,5-dimethyl-2-phenylpyrazol-3-one |
| SMILES | Cc1c(NC(C)c2cc(Cl)ccc2O)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C19H20ClN3O2/c1-12(16-11-14(20)9-10-17(16)24)21-18-13(2)22(3)23(19(18)25)15-7-5-4-6-8-15/h4-12,21,24H,1-3H3 |
| InChIKey | MLDSDLUHNPQCFG-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 59.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.84 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|