C16H18ClNO — CID 828639
4-chloro-2-[(1S)-1-(2,6-dimethylanilino)ethyl]phenol (PubChem CID 828639) has the molecular formula C16H18ClNO and a molecular weight of 275.78 g/mol. Its IUPAC name is 4-chloro-2-[(1S)-1-(2,6-dimethylanilino)ethyl]phenol.
| Compound Name | 4-chloro-2-[(1S)-1-(2,6-dimethylanilino)ethyl]phenol |
|---|---|
| PubChem CID | 828639 |
| Molecular Formula | C16H18ClNO |
| Molecular Weight | 275.78 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 4-chloro-2-[(1S)-1-(2,6-dimethylanilino)ethyl]phenol |
| SMILES | Cc1cccc(C)c1N[C@@H](C)c1cc(Cl)ccc1O |
| InChI | InChI=1S/C16H18ClNO/c1-10-5-4-6-11(2)16(10)18-12(3)14-9-13(17)7-8-15(14)19/h4-9,12,18-19H,1-3H3/t12-/m0/s1 |
| InChIKey | NHTZGQFAVNDRPQ-LBPRGKRZSA-N |
| XLogP | 4.84 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.78 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|