C15H13Cl4N — CID 66252833
2-chloro-6-methyl-N-[1-(2,3,4-trichlorophenyl)ethyl]aniline (PubChem CID 66252833) has the molecular formula C15H13Cl4N and a molecular weight of 349.09 g/mol. Its IUPAC name is 2-chloro-6-methyl-N-[1-(2,3,4-trichlorophenyl)ethyl]aniline.
| Compound Name | 2-chloro-6-methyl-N-[1-(2,3,4-trichlorophenyl)ethyl]aniline |
|---|---|
| PubChem CID | 66252833 |
| Molecular Formula | C15H13Cl4N |
| Molecular Weight | 349.09 g/mol |
| Exact Mass | 346.98 |
| IUPAC Name | 2-chloro-6-methyl-N-[1-(2,3,4-trichlorophenyl)ethyl]aniline |
| SMILES | Cc1cccc(Cl)c1NC(C)c1ccc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C15H13Cl4N/c1-8-4-3-5-12(17)15(8)20-9(2)10-6-7-11(16)14(19)13(10)18/h3-7,9,20H,1-2H3 |
| InChIKey | MEPRXBDXWOASPM-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.09 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|