C21H17ClN3O4- — CID 7434966
(Z)-4-(4-chlorophenyl)-2-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-4-oxobut-2-enoate (PubChem CID 7434966) has the molecular formula C21H17ClN3O4- and a molecular weight of 410.84 g/mol. Its IUPAC name is (Z)-4-(4-chlorophenyl)-2-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-4-oxobut-2-enoate.
| Compound Name | (Z)-4-(4-chlorophenyl)-2-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 7434966 |
| Molecular Formula | C21H17ClN3O4- |
| Molecular Weight | 410.84 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | (Z)-4-(4-chlorophenyl)-2-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-4-oxobut-2-enoate |
| SMILES | Cc1c(N/C(=C\C(=O)c2ccc(Cl)cc2)C(=O)[O-])c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C21H18ClN3O4/c1-13-19(20(27)25(24(13)2)16-6-4-3-5-7-16)23-17(21(28)29)12-18(26)14-8-10-15(22)11-9-14/h3-12,23H,1-2H3,(H,28,29)/p-1/b17-12- |
| InChIKey | DNCNUAQOCZVIGE-ATVHPVEESA-M |
| XLogP | 2.07 |
| TPSA | 96.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.84 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|