C24H21ClN4O3S — CID 2330211
N'-(4-chlorophenyl)sulfonyl-N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)benzenecarboximidamide (PubChem CID 2330211) has the molecular formula C24H21ClN4O3S and a molecular weight of 480.98 g/mol. Its IUPAC name is N'-(4-chlorophenyl)sulfonyl-N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)benzenecarboximidamide.
| Compound Name | N'-(4-chlorophenyl)sulfonyl-N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)benzenecarboximidamide |
|---|---|
| PubChem CID | 2330211 |
| Molecular Formula | C24H21ClN4O3S |
| Molecular Weight | 480.98 g/mol |
| Exact Mass | 480.10 |
| IUPAC Name | N'-(4-chlorophenyl)sulfonyl-N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)benzenecarboximidamide |
| SMILES | Cc1c(NC(=NS(=O)(=O)c2ccc(Cl)cc2)c2ccccc2)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C24H21ClN4O3S/c1-17-22(24(30)29(28(17)2)20-11-7-4-8-12-20)26-23(18-9-5-3-6-10-18)27-33(31,32)21-15-13-19(25)14-16-21/h3-16H,1-2H3,(H,26,27) |
| InChIKey | NJUKCOMLVQZISK-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 85.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.98 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|