C19H16ClN5OS — CID 23939039
1-(5-chloro-2-cyanophenyl)-3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)thiourea (PubChem CID 23939039) has the molecular formula C19H16ClN5OS and a molecular weight of 397.89 g/mol. Its IUPAC name is 1-(5-chloro-2-cyanophenyl)-3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)thiourea.
| Compound Name | 1-(5-chloro-2-cyanophenyl)-3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)thiourea |
|---|---|
| PubChem CID | 23939039 |
| Molecular Formula | C19H16ClN5OS |
| Molecular Weight | 397.89 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | 1-(5-chloro-2-cyanophenyl)-3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)thiourea |
| SMILES | Cc1c(NC(=S)Nc2cc(Cl)ccc2C#N)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C19H16ClN5OS/c1-12-17(18(26)25(24(12)2)15-6-4-3-5-7-15)23-19(27)22-16-10-14(20)9-8-13(16)11-21/h3-10H,1-2H3,(H2,22,23,27) |
| InChIKey | IFASVNDNNLPUMS-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 74.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.89 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|