C25H22ClN5O2S — CID 4858127
3-[(2-chlorophenyl)carbamothioylamino]-N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)benzamide (PubChem CID 4858127) has the molecular formula C25H22ClN5O2S and a molecular weight of 492.00 g/mol. Its IUPAC name is 3-[(2-chlorophenyl)carbamothioylamino]-N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)benzamide.
| Compound Name | 3-[(2-chlorophenyl)carbamothioylamino]-N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)benzamide |
|---|---|
| PubChem CID | 4858127 |
| Molecular Formula | C25H22ClN5O2S |
| Molecular Weight | 492.00 g/mol |
| Exact Mass | 491.12 |
| IUPAC Name | 3-[(2-chlorophenyl)carbamothioylamino]-N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)benzamide |
| SMILES | Cc1c(NC(=O)c2cccc(NC(=S)Nc3ccccc3Cl)c2)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C25H22ClN5O2S/c1-16-22(24(33)31(30(16)2)19-11-4-3-5-12-19)29-23(32)17-9-8-10-18(15-17)27-25(34)28-21-14-7-6-13-20(21)26/h3-15H,1-2H3,(H,29,32)(H2,27,28,34) |
| InChIKey | FEMAPNBAUHOZLE-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 80.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.00 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|