C27H27N5O2S — CID 23737667
N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3-[(4-ethylphenyl)carbamothioylamino]benzamide (PubChem CID 23737667) has the molecular formula C27H27N5O2S and a molecular weight of 485.61 g/mol. Its IUPAC name is N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3-[(4-ethylphenyl)carbamothioylamino]benzamide.
| Compound Name | N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3-[(4-ethylphenyl)carbamothioylamino]benzamide |
|---|---|
| PubChem CID | 23737667 |
| Molecular Formula | C27H27N5O2S |
| Molecular Weight | 485.61 g/mol |
| Exact Mass | 485.19 |
| IUPAC Name | N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3-[(4-ethylphenyl)carbamothioylamino]benzamide |
| SMILES | CCc1ccc(NC(=S)Nc2cccc(C(=O)Nc3c(C)n(C)n(-c4ccccc4)c3=O)c2)cc1 |
| InChI | InChI=1S/C27H27N5O2S/c1-4-19-13-15-21(16-14-19)28-27(35)29-22-10-8-9-20(17-22)25(33)30-24-18(2)31(3)32(26(24)34)23-11-6-5-7-12-23/h5-17H,4H2,1-3H3,(H,30,33)(H2,28,29,35) |
| InChIKey | HDZIOGIDQMPXCR-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 80.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.61 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|