C16H11Cl2N3O2 — CID 830587
N-(2,6-dichloroanilino)-2-(4-methoxyphenyl)-2-oxoethanimidoyl cyanide (PubChem CID 830587) has the molecular formula C16H11Cl2N3O2 and a molecular weight of 348.19 g/mol. Its IUPAC name is N-(2,6-dichloroanilino)-2-(4-methoxyphenyl)-2-oxoethanimidoyl cyanide.
| Compound Name | N-(2,6-dichloroanilino)-2-(4-methoxyphenyl)-2-oxoethanimidoyl cyanide |
|---|---|
| PubChem CID | 830587 |
| Molecular Formula | C16H11Cl2N3O2 |
| Molecular Weight | 348.19 g/mol |
| Exact Mass | 347.02 |
| IUPAC Name | N-(2,6-dichloroanilino)-2-(4-methoxyphenyl)-2-oxoethanimidoyl cyanide |
| SMILES | COc1ccc(C(=O)C(C#N)=NNc2c(Cl)cccc2Cl)cc1 |
| InChI | InChI=1S/C16H11Cl2N3O2/c1-23-11-7-5-10(6-8-11)16(22)14(9-19)20-21-15-12(17)3-2-4-13(15)18/h2-8,21H,1H3 |
| InChIKey | HKUXVNOSUCDVFS-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 74.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.19 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|