C17H13Cl2N3O3 — CID 135348499
(1E)-N-(3,5-dichloroanilino)-2-(3,4-dimethoxyphenyl)-2-oxoethanimidoyl cyanide (PubChem CID 135348499) has the molecular formula C17H13Cl2N3O3 and a molecular weight of 378.22 g/mol. Its IUPAC name is (1E)-N-(3,5-dichloroanilino)-2-(3,4-dimethoxyphenyl)-2-oxoethanimidoyl cyanide.
| Compound Name | (1E)-N-(3,5-dichloroanilino)-2-(3,4-dimethoxyphenyl)-2-oxoethanimidoyl cyanide |
|---|---|
| PubChem CID | 135348499 |
| Molecular Formula | C17H13Cl2N3O3 |
| Molecular Weight | 378.22 g/mol |
| Exact Mass | 377.03 |
| IUPAC Name | (1E)-N-(3,5-dichloroanilino)-2-(3,4-dimethoxyphenyl)-2-oxoethanimidoyl cyanide |
| SMILES | COc1ccc(C(=O)/C(C#N)=N/Nc2cc(Cl)cc(Cl)c2)cc1OC |
| InChI | InChI=1S/C17H13Cl2N3O3/c1-24-15-4-3-10(5-16(15)25-2)17(23)14(9-20)22-21-13-7-11(18)6-12(19)8-13/h3-8,21H,1-2H3/b22-14+ |
| InChIKey | SKUVCXDKVRMNKF-HYARGMPZSA-N |
| XLogP | 4.18 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.22 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|