C17H12F2N2O3 — CID 134125805
(1E)-N-[(2,6-difluorophenyl)methoxy]-2-(4-methoxyphenyl)-2-oxoethanimidoyl cyanide (PubChem CID 134125805) has the molecular formula C17H12F2N2O3 and a molecular weight of 330.29 g/mol. Its IUPAC name is (1E)-N-[(2,6-difluorophenyl)methoxy]-2-(4-methoxyphenyl)-2-oxoethanimidoyl cyanide.
| Compound Name | (1E)-N-[(2,6-difluorophenyl)methoxy]-2-(4-methoxyphenyl)-2-oxoethanimidoyl cyanide |
|---|---|
| PubChem CID | 134125805 |
| Molecular Formula | C17H12F2N2O3 |
| Molecular Weight | 330.29 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | (1E)-N-[(2,6-difluorophenyl)methoxy]-2-(4-methoxyphenyl)-2-oxoethanimidoyl cyanide |
| SMILES | COc1ccc(C(=O)/C(C#N)=N/OCc2c(F)cccc2F)cc1 |
| InChI | InChI=1S/C17H12F2N2O3/c1-23-12-7-5-11(6-8-12)17(22)16(9-20)21-24-10-13-14(18)3-2-4-15(13)19/h2-8H,10H2,1H3/b21-16+ |
| InChIKey | QCLMYUSASMTSDO-LTGZKZEYSA-N |
| XLogP | 3.25 |
| TPSA | 71.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.29 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|