C21H27NO2 — CID 2803437
1-(4-methoxyphenyl)-N-[(2,3,4,5,6-pentamethylphenyl)methoxy]ethanimine (PubChem CID 2803437) has the molecular formula C21H27NO2 and a molecular weight of 325.45 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-N-[(2,3,4,5,6-pentamethylphenyl)methoxy]ethanimine.
| Compound Name | 1-(4-methoxyphenyl)-N-[(2,3,4,5,6-pentamethylphenyl)methoxy]ethanimine |
|---|---|
| PubChem CID | 2803437 |
| Molecular Formula | C21H27NO2 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | 1-(4-methoxyphenyl)-N-[(2,3,4,5,6-pentamethylphenyl)methoxy]ethanimine |
| SMILES | COc1ccc(C(C)=NOCc2c(C)c(C)c(C)c(C)c2C)cc1 |
| InChI | InChI=1S/C21H27NO2/c1-13-14(2)16(4)21(17(5)15(13)3)12-24-22-18(6)19-8-10-20(23-7)11-9-19/h8-11H,12H2,1-7H3 |
| InChIKey | LAVHDWJHYVYSGL-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|