About (E)-1-(6-methoxynaphthalen-2-yl)-N-(2-pyrrolidin-1-ylethoxy)ethanimine;hydrochloride
(E)-1-(6-methoxynaphthalen-2-yl)-N-(2-pyrrolidin-1-ylethoxy)ethanimine;hydrochloride (PubChem CID 24983335) has the molecular formula C19H25ClN2O2
and a molecular weight of 348.87 g/mol. Its IUPAC name is (E)-1-(6-methoxynaphthalen-2-yl)-N-(2-pyrrolidin-1-ylethoxy)ethanimine;hydrochloride.
Molecular Properties
| Compound Name | (E)-1-(6-methoxynaphthalen-2-yl)-N-(2-pyrrolidin-1-ylethoxy)ethanimine;hydrochloride |
| PubChem CID | 24983335 |
| Molecular Formula | C19H25ClN2O2 |
| Molecular Weight | 348.87 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | (E)-1-(6-methoxynaphthalen-2-yl)-N-(2-pyrrolidin-1-ylethoxy)ethanimine;hydrochloride |
| SMILES | COc1ccc2cc(/C(C)=N/OCCN3CCCC3)ccc2c1.Cl |
| InChI | InChI=1S/C19H24N2O2.ClH/c1-15(20-23-12-11-21-9-3-4-10-21)16-5-6-18-14-19(22-2)8-7-17(18)13-16;/h5-8,13-14H,3-4,9-12H2,1-2H3;1H/b20-15+; |
| InChIKey | GUWMQEUWBPJTNQ-QMGGKDRNSA-N |
| XLogP | 4.11 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.87 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-(6-methoxynaphthalen-2-yl)-N-(2-pyrrolidin-1-ylethoxy)ethanimine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-(6-methoxynaphthalen-2-yl)-N-(2-pyrrolidin-1-ylethoxy)ethanimine;hydrochloride?
The IUPAC name of (E)-1-(6-methoxynaphthalen-2-yl)-N-(2-pyrrolidin-1-ylethoxy)ethanimine;hydrochloride (CID 24983335) is (E)-1-(6-methoxynaphthalen-2-yl)-N-(2-pyrrolidin-1-ylethoxy)ethanimine;hydrochloride.
What is the SMILES notation for (E)-1-(6-methoxynaphthalen-2-yl)-N-(2-pyrrolidin-1-ylethoxy)ethanimine;hydrochloride?
The canonical SMILES for (E)-1-(6-methoxynaphthalen-2-yl)-N-(2-pyrrolidin-1-ylethoxy)ethanimine;hydrochloride is COc1ccc2cc(/C(C)=N/OCCN3CCCC3)ccc2c1.Cl.
What is the InChIKey of (E)-1-(6-methoxynaphthalen-2-yl)-N-(2-pyrrolidin-1-ylethoxy)ethanimine;hydrochloride?
The InChIKey is GUWMQEUWBPJTNQ-QMGGKDRNSA-N. The full InChI is InChI=1S/C19H24N2O2.ClH/c1-15(20-23-12-11-21-9-3-4-10-21)16-5-6-18-14-19(22-2)8-7-17(18)13-16;/h5-8,13-14H,3-4,9-12H2,1-2H3;1H/b20-15+;.
What are the key properties of (E)-1-(6-methoxynaphthalen-2-yl)-N-(2-pyrrolidin-1-ylethoxy)ethanimine;hydrochloride?
(E)-1-(6-methoxynaphthalen-2-yl)-N-(2-pyrrolidin-1-ylethoxy)ethanimine;hydrochloride has a molecular weight of 348.87 g/mol, XLogP of 4.11, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-(6-methoxynaphthalen-2-yl)-N-(2-pyrrolidin-1-ylethoxy)ethanimine;hydrochloride is sourced from PubChem (CID 24983335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).