C22H28N2O2 — CID 177313915
(E)-1-[1-(cyclopropylmethyl)piperidin-3-yl]-N-methoxy-1-(6-methoxynaphthalen-2-yl)methanimine (PubChem CID 177313915) has the molecular formula C22H28N2O2 and a molecular weight of 352.48 g/mol. Its IUPAC name is (E)-1-[1-(cyclopropylmethyl)piperidin-3-yl]-N-methoxy-1-(6-methoxynaphthalen-2-yl)methanimine.
| Compound Name | (E)-1-[1-(cyclopropylmethyl)piperidin-3-yl]-N-methoxy-1-(6-methoxynaphthalen-2-yl)methanimine |
|---|---|
| PubChem CID | 177313915 |
| Molecular Formula | C22H28N2O2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | (E)-1-[1-(cyclopropylmethyl)piperidin-3-yl]-N-methoxy-1-(6-methoxynaphthalen-2-yl)methanimine |
| SMILES | CO/N=C(/c1ccc2cc(OC)ccc2c1)C1CCCN(CC2CC2)C1 |
| InChI | InChI=1S/C22H28N2O2/c1-25-21-10-9-17-12-19(8-7-18(17)13-21)22(23-26-2)20-4-3-11-24(15-20)14-16-5-6-16/h7-10,12-13,16,20H,3-6,11,14-15H2,1-2H3/b23-22- |
| InChIKey | MFPPPCFRKLUXQT-FCQUAONHSA-N |
| XLogP | 4.32 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|