C29H40N4O2 — CID 177314116
ethane;(E)-N-methoxy-1-(6-methoxynaphthalen-2-yl)-1-[1-[4-(1H-pyrazol-5-yl)cyclohexyl]piperidin-3-yl]methanimine (PubChem CID 177314116) has the molecular formula C29H40N4O2 and a molecular weight of 476.67 g/mol. Its IUPAC name is ethane;(E)-N-methoxy-1-(6-methoxynaphthalen-2-yl)-1-[1-[4-(1H-pyrazol-5-yl)cyclohexyl]piperidin-3-yl]methanimine.
| Compound Name | ethane;(E)-N-methoxy-1-(6-methoxynaphthalen-2-yl)-1-[1-[4-(1H-pyrazol-5-yl)cyclohexyl]piperidin-3-yl]methanimine |
|---|---|
| PubChem CID | 177314116 |
| Molecular Formula | C29H40N4O2 |
| Molecular Weight | 476.67 g/mol |
| Exact Mass | 476.32 |
| IUPAC Name | ethane;(E)-N-methoxy-1-(6-methoxynaphthalen-2-yl)-1-[1-[4-(1H-pyrazol-5-yl)cyclohexyl]piperidin-3-yl]methanimine |
| SMILES | CC.CO/N=C(/c1ccc2cc(OC)ccc2c1)C1CCCN(C2CCC(c3ccn[nH]3)CC2)C1 |
| InChI | InChI=1S/C27H34N4O2.C2H6/c1-32-25-12-9-20-16-22(6-5-21(20)17-25)27(30-33-2)23-4-3-15-31(18-23)24-10-7-19(8-11-24)26-13-14-28-29-26;1-2/h5-6,9,12-14,16-17,19,23-24H,3-4,7-8,10-11,15,18H2,1-2H3,(H,28,29);1-2H3/b30-27-; |
| InChIKey | IDTNDXSKESETJW-NHUYCKTKSA-N |
| XLogP | 6.39 |
| TPSA | 62.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.67 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|