C22H28N2OS — CID 177313888
(6-methoxynaphthalen-2-yl)-[1-(thian-4-yl)piperidin-3-yl]methanimine (PubChem CID 177313888) has the molecular formula C22H28N2OS and a molecular weight of 368.55 g/mol. Its IUPAC name is (6-methoxynaphthalen-2-yl)-[1-(thian-4-yl)piperidin-3-yl]methanimine.
| Compound Name | (6-methoxynaphthalen-2-yl)-[1-(thian-4-yl)piperidin-3-yl]methanimine |
|---|---|
| PubChem CID | 177313888 |
| Molecular Formula | C22H28N2OS |
| Molecular Weight | 368.55 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | (6-methoxynaphthalen-2-yl)-[1-(thian-4-yl)piperidin-3-yl]methanimine |
| SMILES | [H]/N=C(\c1ccc2cc(OC)ccc2c1)C1CCCN(C2CCSCC2)C1 |
| InChI | InChI=1S/C22H28N2OS/c1-25-21-7-6-16-13-18(5-4-17(16)14-21)22(23)19-3-2-10-24(15-19)20-8-11-26-12-9-20/h4-7,13-14,19-20,23H,2-3,8-12,15H2,1H3/b23-22+ |
| InChIKey | PJBHXJOPBLMWET-GHVJWSGMSA-N |
| XLogP | 4.82 |
| TPSA | 36.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.55 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|