C23H30N2O2 — CID 172914172
(E)-1-[(3R)-1-cyclopentylpiperidin-3-yl]-N-methoxy-1-(6-methoxynaphthalen-2-yl)methanimine (PubChem CID 172914172) has the molecular formula C23H30N2O2 and a molecular weight of 366.51 g/mol. Its IUPAC name is (E)-1-[(3R)-1-cyclopentylpiperidin-3-yl]-N-methoxy-1-(6-methoxynaphthalen-2-yl)methanimine.
| Compound Name | (E)-1-[(3R)-1-cyclopentylpiperidin-3-yl]-N-methoxy-1-(6-methoxynaphthalen-2-yl)methanimine |
|---|---|
| PubChem CID | 172914172 |
| Molecular Formula | C23H30N2O2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | (E)-1-[(3R)-1-cyclopentylpiperidin-3-yl]-N-methoxy-1-(6-methoxynaphthalen-2-yl)methanimine |
| SMILES | CO/N=C(/c1ccc2cc(OC)ccc2c1)[C@@H]1CCCN(C2CCCC2)C1 |
| InChI | InChI=1S/C23H30N2O2/c1-26-22-12-11-17-14-19(10-9-18(17)15-22)23(24-27-2)20-6-5-13-25(16-20)21-7-3-4-8-21/h9-12,14-15,20-21H,3-8,13,16H2,1-2H3/b24-23-/t20-/m1/s1 |
| InChIKey | OOQFGLNLHKAAOI-LRVSTDGRSA-N |
| XLogP | 4.85 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|