C25H34N4O3 — CID 177313885
[3-[3-[(E)-N-methoxy-C-(6-methoxynaphthalen-2-yl)carbonimidoyl]piperidin-1-yl]cyclohexyl]urea (PubChem CID 177313885) has the molecular formula C25H34N4O3 and a molecular weight of 438.57 g/mol. Its IUPAC name is [3-[3-[(E)-N-methoxy-C-(6-methoxynaphthalen-2-yl)carbonimidoyl]piperidin-1-yl]cyclohexyl]urea.
| Compound Name | [3-[3-[(E)-N-methoxy-C-(6-methoxynaphthalen-2-yl)carbonimidoyl]piperidin-1-yl]cyclohexyl]urea |
|---|---|
| PubChem CID | 177313885 |
| Molecular Formula | C25H34N4O3 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | [3-[3-[(E)-N-methoxy-C-(6-methoxynaphthalen-2-yl)carbonimidoyl]piperidin-1-yl]cyclohexyl]urea |
| SMILES | CO/N=C(/c1ccc2cc(OC)ccc2c1)C1CCCN(C2CCCC(NC(N)=O)C2)C1 |
| InChI | InChI=1S/C25H34N4O3/c1-31-23-11-10-17-13-19(9-8-18(17)14-23)24(28-32-2)20-5-4-12-29(16-20)22-7-3-6-21(15-22)27-25(26)30/h8-11,13-14,20-22H,3-7,12,15-16H2,1-2H3,(H3,26,27,30)/b28-24- |
| InChIKey | PFNYGZNLBNQLLH-COOPMVRXSA-N |
| XLogP | 3.89 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|