C27H34N4O2 — CID 177314128
(E)-N-methoxy-1-(6-methoxynaphthalen-2-yl)-1-[1-[4-(1H-pyrazol-4-yl)cyclohexyl]piperidin-3-yl]methanimine (PubChem CID 177314128) has the molecular formula C27H34N4O2 and a molecular weight of 446.60 g/mol. Its IUPAC name is (E)-N-methoxy-1-(6-methoxynaphthalen-2-yl)-1-[1-[4-(1H-pyrazol-4-yl)cyclohexyl]piperidin-3-yl]methanimine.
| Compound Name | (E)-N-methoxy-1-(6-methoxynaphthalen-2-yl)-1-[1-[4-(1H-pyrazol-4-yl)cyclohexyl]piperidin-3-yl]methanimine |
|---|---|
| PubChem CID | 177314128 |
| Molecular Formula | C27H34N4O2 |
| Molecular Weight | 446.60 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | (E)-N-methoxy-1-(6-methoxynaphthalen-2-yl)-1-[1-[4-(1H-pyrazol-4-yl)cyclohexyl]piperidin-3-yl]methanimine |
| SMILES | CO/N=C(/c1ccc2cc(OC)ccc2c1)C1CCCN(C2CCC(c3cn[nH]c3)CC2)C1 |
| InChI | InChI=1S/C27H34N4O2/c1-32-26-12-9-20-14-22(6-5-21(20)15-26)27(30-33-2)23-4-3-13-31(18-23)25-10-7-19(8-11-25)24-16-28-29-17-24/h5-6,9,12,14-17,19,23,25H,3-4,7-8,10-11,13,18H2,1-2H3,(H,28,29)/b30-27- |
| InChIKey | LJYNDRCYVRYCSS-IKPAITLHSA-N |
| XLogP | 5.36 |
| TPSA | 62.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.60 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|