C26H38N2O2 — CID 177313994
ethane;[1-(4-methoxycyclohexyl)piperidin-3-yl]-(6-methoxynaphthalen-2-yl)methanimine (PubChem CID 177313994) has the molecular formula C26H38N2O2 and a molecular weight of 410.60 g/mol. Its IUPAC name is ethane;[1-(4-methoxycyclohexyl)piperidin-3-yl]-(6-methoxynaphthalen-2-yl)methanimine.
| Compound Name | ethane;[1-(4-methoxycyclohexyl)piperidin-3-yl]-(6-methoxynaphthalen-2-yl)methanimine |
|---|---|
| PubChem CID | 177313994 |
| Molecular Formula | C26H38N2O2 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.29 |
| IUPAC Name | ethane;[1-(4-methoxycyclohexyl)piperidin-3-yl]-(6-methoxynaphthalen-2-yl)methanimine |
| SMILES | CC.[H]/N=C(\c1ccc2cc(OC)ccc2c1)C1CCCN(C2CCC(OC)CC2)C1 |
| InChI | InChI=1S/C24H32N2O2.C2H6/c1-27-22-11-8-21(9-12-22)26-13-3-4-20(16-26)24(25)19-6-5-18-15-23(28-2)10-7-17(18)14-19;1-2/h5-7,10,14-15,20-22,25H,3-4,8-9,11-13,16H2,1-2H3;1-2H3/b25-24+; |
| InChIKey | PSMOSGMJNCVDPR-QREUMGABSA-N |
| XLogP | 5.91 |
| TPSA | 45.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|