C17H25NO2S — CID 50966979
(3S,4S)-4-(3-methoxyphenyl)-1-(thian-4-yl)piperidin-3-ol (PubChem CID 50966979) has the molecular formula C17H25NO2S and a molecular weight of 307.46 g/mol. Its IUPAC name is (3S,4S)-4-(3-methoxyphenyl)-1-(thian-4-yl)piperidin-3-ol.
| Compound Name | (3S,4S)-4-(3-methoxyphenyl)-1-(thian-4-yl)piperidin-3-ol |
|---|---|
| PubChem CID | 50966979 |
| Molecular Formula | C17H25NO2S |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | (3S,4S)-4-(3-methoxyphenyl)-1-(thian-4-yl)piperidin-3-ol |
| SMILES | COc1cccc([C@@H]2CCN(C3CCSCC3)C[C@H]2O)c1 |
| InChI | InChI=1S/C17H25NO2S/c1-20-15-4-2-3-13(11-15)16-5-8-18(12-17(16)19)14-6-9-21-10-7-14/h2-4,11,14,16-17,19H,5-10,12H2,1H3/t16-,17+/m0/s1 |
| InChIKey | YMDRBURSLYTMQG-DLBZAZTESA-N |
| XLogP | 2.74 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |