C22H27NO2 — CID 121479074
[1-(cyclopropylmethyl)piperidin-3-yl]-(6-methoxy-5-methylnaphthalen-2-yl)methanone (PubChem CID 121479074) has the molecular formula C22H27NO2 and a molecular weight of 337.46 g/mol. Its IUPAC name is [1-(cyclopropylmethyl)piperidin-3-yl]-(6-methoxy-5-methylnaphthalen-2-yl)methanone.
| Compound Name | [1-(cyclopropylmethyl)piperidin-3-yl]-(6-methoxy-5-methylnaphthalen-2-yl)methanone |
|---|---|
| PubChem CID | 121479074 |
| Molecular Formula | C22H27NO2 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | [1-(cyclopropylmethyl)piperidin-3-yl]-(6-methoxy-5-methylnaphthalen-2-yl)methanone |
| SMILES | COc1ccc2cc(C(=O)C3CCCN(CC4CC4)C3)ccc2c1C |
| InChI | InChI=1S/C22H27NO2/c1-15-20-9-7-18(12-17(20)8-10-21(15)25-2)22(24)19-4-3-11-23(14-19)13-16-5-6-16/h7-10,12,16,19H,3-6,11,13-14H2,1-2H3 |
| InChIKey | HFLPKVONUATGTB-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |