C23H26N2O2 — CID 121479119
2-[6-[1-(cyclopropylmethyl)piperidine-3-carbonyl]-2-methoxynaphthalen-1-yl]acetonitrile (PubChem CID 121479119) has the molecular formula C23H26N2O2 and a molecular weight of 362.47 g/mol. Its IUPAC name is 2-[6-[1-(cyclopropylmethyl)piperidine-3-carbonyl]-2-methoxynaphthalen-1-yl]acetonitrile.
| Compound Name | 2-[6-[1-(cyclopropylmethyl)piperidine-3-carbonyl]-2-methoxynaphthalen-1-yl]acetonitrile |
|---|---|
| PubChem CID | 121479119 |
| Molecular Formula | C23H26N2O2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 2-[6-[1-(cyclopropylmethyl)piperidine-3-carbonyl]-2-methoxynaphthalen-1-yl]acetonitrile |
| SMILES | COc1ccc2cc(C(=O)C3CCCN(CC4CC4)C3)ccc2c1CC#N |
| InChI | InChI=1S/C23H26N2O2/c1-27-22-9-7-17-13-18(6-8-20(17)21(22)10-11-24)23(26)19-3-2-12-25(15-19)14-16-4-5-16/h6-9,13,16,19H,2-5,10,12,14-15H2,1H3 |
| InChIKey | SSSZOXBPBNLSFS-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |